1409940-46-0
Chemical Structure
Azide-phenylalanine hydrochloride
Synonym(s): UAA crosslinker 2
- CAS No.: 1409940-46-0
- Formula:C9H11ClN4O2
- Molecular Weight:242.66
IUPAC Name: (S)-2-amino-3-(3-azidophenyl)propanoic acid hydrochloride
InChIKey: JLAUMXKZFHUSPQ-QRPNPIFTSA-N
SMILES: N[C@H](C(O)=O)CC1=CC=CC(N=[N+]=[N-])=C1.Cl
Biological Activity: Azide-phenylalanine hydrochloride is a phenylalanine derivative. Azide-phenylalanine (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azide-phenylalanine hydrochloride | Azide-phenylalanine hydrochloride is a phenylalanine derivative. Azide-phenylalanine (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
