7612-88-6
Chemical Structure
4-(Bromomethyl)benzenesulfonyl fluoride
Synonym(s): Fluorosulfonylbenzyl bromide
- CAS No.: 7612-88-6
- Formula:C7H6BrFO2S
- Molecular Weight:253.09
IUPAC Name: 4-(bromomethyl)benzenesulfonyl fluoride
InChIKey: WWAPDVQUZYCNCR-UHFFFAOYSA-N
SMILES: O=S(F)(C1=CC=C(CBr)C=C1)=O
Biological Activity: 4-(Bromomethyl)benzenesulfonyl fluoride (Fluorosulfonylbenzyl bromide) is an important chemical reagent with good biological activity. 4-(Bromomethyl)benzenesulfonyl fluoride can be used to prepare various bioactive molecules, especially in the process of compound discovery and synthesis, showing excellent reactivity. 4-(Bromomethyl)benzenesulfonyl fluoride is often used in the development of new biological agents, promoting the research progress of organic chemistry and biochemistry.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-(Bromomethyl)benzenesulfonyl fluoride | 97.11% | 4-(Bromomethyl)benzenesulfonyl fluoride (Fluorosulfonylbenzyl bromide) is an important chemical reagent with good biological activity. 4-(Bromomethyl)benzenesulfonyl fluoride can be used to prepare various bioactive molecules, especially in the process of compound discovery and synthesis, showing excellent reactivity. 4-(Bromomethyl)benzenesulfonyl fluoride is often used in the development of new biological agents, promoting the research progress of organic chemistry and biochemistry. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
