101758-79-6
Chemical Structure
OP-2507
- CAS No.: 101758-79-6
- Formula:C25H41NO4
- Molecular Weight:419.60
IUPAC Name: methyl 5-((3aR,4R,5R,6aS)-5-hydroxy-4-((S,E)-3-hydroxy-3-((1r,4R)-4-propylcyclohexyl)prop-1-en-1-yl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-yl)pentanoate
InChIKey: UQEOPLABKYFAJH-SXFQMNBESA-N
SMILES: O=C(OC)CCCCC1=N[C@]2([H])[C@]([C@@H](/C=C/[C@@H](O)[C@H]3CC[C@@H](CCC)CC3)[C@H](O)C2)([H])C1
Biological Activity:
OP-2507 is a prostacyclin analog. OP-2507 can increase brain glucose levels in mice, suppress the breakdown of energy metabolism under hypoxic conditions, and has a protective effect against changes in cyclic nucleotides in hypoxic brain tissue (specifically, an increase in cyclic AMP and a decrease in cyclic GMP). OP-2507 provides protective effects against brain hypoxia and edema[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
OP-2507 | OP-2507 is a prostacyclin analog. OP-2507 can increase brain glucose levels in mice, suppress the breakdown of energy metabolism under hypoxic conditions, and has a protective effect against changes in cyclic nucleotides in hypoxic brain tissue (specifically, an increase in cyclic AMP and a decrease in cyclic GMP). OP-2507 provides protective effects against brain hypoxia and edema. |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||