1263047-53-5
Chemical Structure
Fmoc-D-Aha-OH
- CAS No.: 1263047-53-5
- Formula:C19H18N4O4
- Molecular Weight:366.37
IUPAC Name: 6-bromo-4-(hydroxymethyl)-8-methylphthalazin-1(2H)-one
InChIKey: CLEZARXVEABQBI-QGZVFWFLSA-N
SMILES: [N-]=[N+]=NCC[C@H](C(O)=O)NC(OCC1C2=CC=CC=C2C3=CC=CC=C31)=O
Biological Activity: Fmoc-D-Aha-OH is a click chemistry reagent containing an azide[1]. Fmoc-D-Aha-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Fmoc-D-Aha-OH | 97.75% | Fmoc-D-Aha-OH is a click chemistry reagent containing an azide. Fmoc-D-Aha-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||