1395472-39-5
Chemical Structure
C902
- CAS No.: 1395472-39-5
- Formula:C27H17BrN2O6S
- Molecular Weight:577.40
SMILES: O=C(O)C1=CC(N2C(C3=CC=C(C4=NC=CS4)C=C3)C(C(C5=CC=C(Br)C=C5)=O)=C(O)C2=O)=CC=C1O
Biological Activity: C902 is a cysteine residue in the RAG1 protein, that binds to Zn2+ ion and contributes to the DNA cleavage[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
C902 | C902 is a cysteine residue in the RAG1 protein, that binds to Zn2+ ion and contributes to the DNA cleavage. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||