1422540-98-4
Chemical Structure
Azido-PEG4-4-nitrophenyl carbonate
- CAS. Nr.: 1422540-98-4
- Formula:C15H20N4O8
- Molecular Weight:384.34
IUPAC Name: 2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl (4-nitrophenyl) carbonate
InChIKey: NEBKYWFZPUXXJD-UHFFFAOYSA-N
SMILES: O=C(OC1=CC=C([N+]([O-])=O)C=C1)OCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG4-4-nitrophenyl carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG4-4-nitrophenyl carbonate is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG4-4-nitrophenyl carbonate | 98.88% | Azido-PEG4-4-nitrophenyl carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG4-4-nitrophenyl carbonate is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
