1613321-02-0
Chemical Structure
6-Azidohexanoyl-Val-Cit-PAB
- CAS No.: 1613321-02-0
- Formula:C31H41N9O9
- Molecular Weight:683.71
IUPAC Name: 4-((S)-2-((S)-2-(6-azidohexanamido)-3-methylbutanamido)-5-ureidopentanamido)benzyl (4-nitrophenyl) carbonate
InChIKey: RMDFMOLSVRETCO-BDYUSTAISA-N
SMILES: O=[N+]([O-])C(C=C1)=CC=C1OC(OCC(C=C2)=CC=C2NC([C@H](CCCNC(N)=O)NC([C@H](C(C)C)NC(CCCCCN=[N+]=[N-])=O)=O)=O)=O
Biological Activity: 6-Azidohexanoyl-Val-Cit-PAB is a click chemistry reagent that can be used to synthesis vaccine[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6-Azidohexanoyl-Val-Cit-PAB | 6-Azidohexanoyl-Val-Cit-PAB is a click chemistry reagent that can be used to synthesis vaccine. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||