178825-03-1
Chemical Structure
Pulsatiloside B
- CAS No.: 178825-03-1
- Formula:C65H106O32
- Molecular Weight:1399.52
InChIKey: YBMKVZLOJMTQKX-IHWRWCOCSA-N
SMILES: O=C([C@]12CCC(C)(C[C@@]1([H])C3=CC[C@]4([H])[C@]5(CC[C@@H]([C@@](CO)([C@]5([H])CC[C@]4([C@@]3(CC2)C)C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)O[C@@H]7O[C@@H]([C@H]([C@@H]([C@H]7O)O)O)CO)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)C)C)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO[C@@H]%10O[C@@H]([C@H]([C@@H]([C@H]%10O)O)O[C@@H]%11O[C@H]([C@@H]([C@H]([C@H]%11O)O)O)C)CO)O)O)O
Biological Activity: Pulsatiloside B is a triterpenoid saponin present in the roots of Pulsatilla campanella. Pulsatilosides B exerts an inhibitory effect on the motility of human sperm in vitro[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pulsatiloside B | Pulsatiloside B is a triterpenoid saponin present in the roots of Pulsatilla campanella. Pulsatilosides B exerts an inhibitory effect on the motility of human sperm in vitro. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
