1841402-73-0
Chemical Structure
Faridoxorubicin
Synonym(s): AVA-6000
- CAS No.: 1841402-73-0
- Formula:C41H44N4O14
- Molecular Weight:816.81
SMILES: OC1=C(C(C2=CC=CC(OC)=C2C3=O)=O)C3=C(O)C4=C1C[C@](C(CO)=O)(O)C[C@@H]4O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O)NC([C@H]6N(CCC6)C([C@@H](C)NC(C7=CC=NC=C7)=O)=O)=O
Biological Activity: Faridoxorubicin (AVA-6000) is a prodrug targeting fibroblast activation protein α (FAPα). Faridoxorubicin releases active doxorubicin through FAPα-mediated cleavage, enhancing intratumoral drug exposure and reducing cardiac toxicity. Faridoxorubicin is promising for research of solid tumors (e.g., colorectal cancer liver metastasis)[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Faridoxorubicin | Faridoxorubicin (AVA-6000) is a prodrug targeting fibroblast activation protein α (FAPα). Faridoxorubicin releases active doxorubicin through FAPα-mediated cleavage, enhancing intratumoral drug exposure and reducing cardiac toxicity. Faridoxorubicin is promising for research of solid tumors (e.g., colorectal cancer liver metastasis). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords