185980-89-6
Chemical Structure
Nostopeptin B
- CAS No.: 185980-89-6
- Formula:C46H70N8O12
- Molecular Weight:927.09
InChIKey: QMXYZAMGCKYKHQ-FHNQGLGHSA-N
SMILES: O=C(N(C1)C(C(N[C@H](C(NC(CCC2O)([H])C(N2[C@@]3([H])[C@@H](C)CC)=O)=O)CC(C)C)=O)([H])C(OC([C@](NC([C@@H](N(C3=O)C)CC(C=C4)=CC=C4O)=O)([H])[C@@H](C)CC)=O)([H])C1C)[C@@H](NC(C)=O)CCC(N)=O
Biological Activity: Nostopeptin B is a cyclic dipeptide that can be isolated from N. minutum (NIES-26). The structure of Nostopeptin B contains Ahp (3-amino-6-hydroxy-2-piperidone), which exhibits effective inhibition against elastase and chymotrypsin[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Nostopeptin B | Nostopeptin B is a cyclic dipeptide that can be isolated from N. minutum (NIES-26). The structure of Nostopeptin B contains Ahp (3-amino-6-hydroxy-2-piperidone), which exhibits effective inhibition against elastase and chymotrypsin. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||