1984862-48-7
Chemical Structure
OABK hydrochloride
- CAS No.: 1984862-48-7
- Formula:C14H20ClN5O4
- Molecular Weight:357.79
IUPAC Name: N6-(((2-azidobenzyl)oxy)carbonyl)-L-lysine hydrochloride
InChIKey: JTXGXTOOHZYZDP-MERQFXBCSA-N
SMILES: N[C@@H](CCCCNC(OCC1=CC=CC=C1N=[N+]=[N-])=O)C(O)=O.[H]Cl
Biological Activity: OABK hydrochloride is a small-molecule switch that can be used to control protein activity. OABK (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
OABK hydrochloride | 95.07% | OABK hydrochloride is a small-molecule switch that can be used to control protein activity. OABK (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||