2088650-87-5
Chemical Structure
Abemaciclib impurity 1-d5
Synonym(s): 6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole-d5
- CAS No.: 2088650-87-5
- Formula:C11H7D5BrFN2
- Molecular Weight:276.16
InChIKey: SJQZRZLUEGCXFN-RAVRHURDSA-N
SMILES: FC1=C([2H])C(Br)=C([2H])C2=C1N=C(C([2H])([2H])[2H])N2C(C)C
Biological Activity: Abemaciclib impurity 1-d5 (6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole-d5) is the deuterium labeled Abemaciclib impurity 1. Abemaciclib Impurity 1 (6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole) is a drug intermediate for synthesis of various active compounds.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Abemaciclib impurity 1-d5 | Abemaciclib impurity 1-d5 (6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole-d5) is the deuterium labeled Abemaciclib impurity 1. Abemaciclib Impurity 1 (6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole) is a drug intermediate for synthesis of various active compounds. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Abemaciclib impurity 1-d12 | Abemaciclib impurity 1-d12 (6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole-d12) is the deuterium labeled Abemaciclib impurity 1. Abemaciclib Impurity 1 (6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole) is a drug intermediate for synthesis of various active compounds. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Abemaciclib Impurity 1 | 99.42% | Abemaciclib Impurity 1 (6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole) is a drug intermediate for synthesis of various active compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||