2130955-10-9
Chemical Structure
Sulfo-Cy5-Mal
Synonym(s): Sulfo-cyanine5 maleimide
- CAS No.: 2130955-10-9
- Formula:C38H44N4O9S2
- Molecular Weight:764.91
InChIKey: OLRTZDDIXXDJPO-UHFFFAOYSA-N
SMILES: O=C1C=CC(N1CCNC(CCCCCN2C3=CC=C(S(=O)(O)=O)C=C3C(C)(C)/C2=C\C=C\C=C\C4=[N+](C)C5=C(C4(C)C)C=C(S(=O)([O-])=O)C=C5)=O)=O
Biological Activity: Sulfo-Cy5-Mal is a fluorescent dye derivative composed of a CY5 dye and a maleimide functional group. Sulfo-Cy5-Mal specifically covalently binds to thiol-containing (-SH) biomolecules. Sulfo-Cy5-Mal can be used for protein labeling, antibody conjugation, molecular imaging, and drug delivery studies (Ex/Em = 633 nm/670 nm)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sulfo-Cy5-Mal | 99.33% | Sulfo-Cy5-Mal is a fluorescent dye derivative composed of a CY5 dye and a maleimide functional group. Sulfo-Cy5-Mal specifically covalently binds to thiol-containing (-SH) biomolecules. Sulfo-Cy5-Mal can be used for protein labeling, antibody conjugation, molecular imaging, and drug delivery studies (Ex/Em = 633 nm/670 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||