2250217-31-1
Chemical Structure
TCO-PEG2-acid
- CAS No.: 2250217-31-1
- Formula:C16H27NO6
- Molecular Weight:329.39
InChIKey: QSADMTUKGBWTTN-UPHRSURJSA-N
SMILES: O=C(CCOCCOCCNC(OC1CC/C=C\CCC1)=O)O
Biological Activity: TCO-PEG2-acid is a click chemistry linker containing a TCO (trans-cycloctene) and a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators such as EDC. TCO reagent is highly reactive with tetrazine in an inverse electron demand Diels Alder (IEDDA) reaction followed by a retro-DA reaction. The hydrophilic PEG spacer increases solubility in aqueous media.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TCO-PEG2-acid | TCO-PEG2-acid is a click chemistry linker containing a TCO (trans-cycloctene) and a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators such as EDC. TCO reagent is highly reactive with tetrazine in an inverse electron demand Diels Alder (IEDDA) reaction followed by a retro-DA reaction. The hydrophilic PEG spacer increases solubility in aqueous media. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||