2399455-45-7
Chemical Structure
Lenalidomide 4'-PEG1-azide
- CAS No.: 2399455-45-7
- Formula:C17H20N6O4
- Molecular Weight:372.38
InChIKey: CBXNEHSOULAFIX-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCNC1=CC=CC2=C1CN(C3C(NC(CC3)=O)=O)C2=O
Biological Activity: Lenalidomide 4'-PEG1-azide (Compound 4g) is a lenalidomide-derived azide. Lenalidomide 4'-PEG1-azide incorporates the Lenalidomide based cereblon ligand and a linker. Lenalidomide 4'-PEG1-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lenalidomide 4'-PEG1-azide | Lenalidomide 4'-PEG1-azide (Compound 4g) is a lenalidomide-derived azide. Lenalidomide 4'-PEG1-azide incorporates the Lenalidomide based cereblon ligand and a linker. Lenalidomide 4'-PEG1-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||