2414481-39-1
Chemical Structure
Obtusichromoneside B
- CAS No.: 2414481-39-1
- Formula:C20H26O11
- Molecular Weight:442.41
InChIKey: WETUQJHMQSVGHL-UXRKMBKTSA-N
SMILES: OC1=CC(O)=C(C(C=C(O2)C[C@@H](O)C[C@H](O)C)=O)C2=C1[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO
Biological Activity: Obtusichromoneside B is a novel naphthyl glycoside compound that can be isolated from Cassia obtusifolia seeds. Cassia obtusifolia possesses various physiological functions, including neuroprotection, anti-inflammatory effects, and hepatoprotection.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Obtusichromoneside B | Obtusichromoneside B is a novel naphthyl glycoside compound that can be isolated from Cassia obtusifolia seeds. Cassia obtusifolia possesses various physiological functions, including neuroprotection, anti-inflammatory effects, and hepatoprotection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||