2415545-08-1
Chemical Structure
RS17
- CAS No.: 2415545-08-1
- Formula:C96H130N30O26
- Molecular Weight:2120.24
SMILES: O=C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC1=CC=C(C=C1)O)C(N[C@@H](CCCCN)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC(O)=O)C(NCC(NCC(N[C@@H](CC2=CNC3=CC=CC=C23)C(N[C@@H](CO)C(N[C@@H](CC4=CNC=N4)C(N[C@@H](CC5=CNC6=CC=CC=C56)C(N[C@@H](CO)C(N7[C@@H](CCC7)C(N[C@@H](CC8=CNC9=CC=CC=C89)C(N[C@@H](CO)C(N[C@@H](CO)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCNC(N)=N)N
Biological Activity: RS17 is an anti-tumor peptide designed to bind specifically to the CD47 molecule and block the interaction between CD47 and its ligand, SIRPα, on the surface membrane of macrophages. The main regulatory mechanism of RS17 is to prevent CD47 from transmitting selective phagocytosis signals to SIRPα by binding to CD47, so that macrophages do not recognize tumor cells as their own tissue, but phagocytose them as foreign substances, thereby inhibiting immune escape of tumor cells. RS17 can be used to study the mechanism of anti-tumor response and immune escape[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
RS17 | 99.84% | RS17 is an anti-tumor peptide designed to bind specifically to the CD47 molecule and block the interaction between CD47 and its ligand, SIRPα, on the surface membrane of macrophages. The main regulatory mechanism of RS17 is to prevent CD47 from transmitting selective phagocytosis signals to SIRPα by binding to CD47, so that macrophages do not recognize tumor cells as their own tissue, but phagocytose them as foreign substances, thereby inhibiting immune escape of tumor cells. RS17 can be used to study the mechanism of anti-tumor response and immune escape. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||