2741640-52-6
Chemical Structure
BCN-PEG4-hydrazide
- CAS No.: 2741640-52-6
- Formula:C22H37N3O7
- Molecular Weight:455.55
IUPAC Name: ((1R,8S,9r)-bicyclo[6.1.0]non-4-yn-9-yl)methyl (15-hydrazinyl-15-oxo-3,6,9,12-tetraoxapentadecyl)carbamate
InChIKey: IYCQJGJIYDHELJ-PMOLBWCYSA-N
SMILES: [H][C@@]12[C@@](CCC#CCC2)([H])[C@H]1COC(NCCOCCOCCOCCOCCC(NN)=O)=O
Biological Activity: BCN-PEG4-hydrazide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. BCN-PEG4-hydrazide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BCN-PEG4-hydrazide | BCN-PEG4-hydrazide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. BCN-PEG4-hydrazide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||