276680-63-8
Chemical Structure
DX-8951 Hydroxy-acid
- CAS No.: 276680-63-8
- Formula:C24H24FN3O5
- Molecular Weight:453.46
InChIKey: FSIYVZXCHYTWIP-FYSMJZIKSA-N
SMILES: FC1=CC2=NC3=C(CN4C3=CC([C@@](C(O)=O)(O)CC)=C(CO)C4=O)C([C@@H](N)CC5)=C2C5=C1C
Biological Activity: DX-8951 Hydroxy-acid is a prodrug of phosphoramide. ProAX can effectively increase intracellular ATP levels. DX-8951 Hydroxy-acid activates the AMPK signaling pathway by increasing the AMP/ATP ratio. DX-8951 Hydroxy-acid can enhance mitochondrial function and antioxidant capacity while reducing reactive oxygen species (ROS) levels. DX-8951 Hydroxy-acid has shown significant anti-aging and longevity effects in both human fibroblast and nematode models[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DX-8951 Hydroxy-acid | DX-8951 Hydroxy-acid is a prodrug of phosphoramide. ProAX can effectively increase intracellular ATP levels. DX-8951 Hydroxy-acid activates the AMPK signaling pathway by increasing the AMP/ATP ratio. DX-8951 Hydroxy-acid can enhance mitochondrial function and antioxidant capacity while reducing reactive oxygen species (ROS) levels. DX-8951 Hydroxy-acid has shown significant anti-aging and longevity effects in both human fibroblast and nematode models. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
