2803338-37-4
Chemical Structure
Tos-PEG6-acid
- CAS No.: 2803338-37-4
- Formula:C20H32O10S
- Molecular Weight:464.53
IUPAC Name: 1-(tosyloxy)-3,6,9,12,15-pentaoxaoctadecan-18-oic acid
InChIKey: ZCYKJYDCRMDDLW-UHFFFAOYSA-N
SMILES: O=C(CCOCCOCCOCCOCCOCCOS(=O)(C1=CC=C(C)C=C1)=O)O
Biological Activity: Tos-PEG6-acid is a PEG linker containing a tosyl group and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The tosyl group is a very good leaving group for nucleophilic substitution reactions. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. HATU) to form a stable amide bond.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tos-PEG6-acid | Tos-PEG6-acid is a PEG linker containing a tosyl group and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The tosyl group is a very good leaving group for nucleophilic substitution reactions. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. HATU) to form a stable amide bond. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||