3127008-95-8
Chemical Structure
(Rac)-TNG961
- CAS No.: 3127008-95-8
- Formula:C28H24F3N3O3S
- Molecular Weight:539.57
InChIKey: ZULFEJXMTVXZMW-UHFFFAOYSA-N
SMILES: O=C(NC1=O)CCC1C(C=C2)=CC3=C2C(NC(NC(C)(C)C4=CC(C=CC(C(F)(F)F)=C5)=C5S4)=O)=CC=C3
Biological Activity: (Rac)-TNG961 is the rac isomer of TNG961 (HY-183115). TNG961 is a selective and orally active CRBN-mediated HBS1L molecular glue degrader. TNG961 induces formation of an HBS1L-TNG961-CRBN ternary complex, leading to potent degradation of HBS1L and secondary destabilization of its binding partner PELO. TNG961 can reduce HBS1L protein levels, thereby disrupting the PELO region involved in ribosome rescue. TNG961 can be used for the study of FOCAD-deficient cancers, such as pancreatic cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(Rac)-TNG961 | (Rac)-TNG961 is the rac isomer of TNG961 (HY-183115). TNG961 is a selective and orally active CRBN-mediated HBS1L molecular glue degrader. TNG961 induces formation of an HBS1L-TNG961-CRBN ternary complex, leading to potent degradation of HBS1L and secondary destabilization of its binding partner PELO. TNG961 can reduce HBS1L protein levels, thereby disrupting the PELO region involved in ribosome rescue. TNG961 can be used for the study of FOCAD-deficient cancers, such as pancreatic cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||