350595-60-7
Chemical Structure
T-0902611
- CAS No.: 350595-60-7
- Formula:C13H16N6O3
- Molecular Weight:304.30
IUPAC Name: (S)-4-(4-(1H-imidazol-1-yl)-6-methyl-5-nitropyrimidin-2-yl)-3-methylmorpholine
InChIKey: FCIGOVAQWMOIDY-VIFPVBQESA-N
SMILES: CC1=C(C(N2C=CN=C2)=NC(N3[C@H](COCC3)C)=N1)[N+]([O-])=O
Biological Activity: T-0902611 is an inhibitor targeting the human cytomegalovirus HCMV helicase‑primase complex. T-0902611 covalently modifies its target components, thereby disrupting complex function and inhibiting HCMV DNA replication. T-0902611 can be used in studies related to human cytomegalovirus infection[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
T-0902611 | T-0902611 is an inhibitor targeting the human cytomegalovirus HCMV helicase‑primase complex. T-0902611 covalently modifies its target components, thereby disrupting complex function and inhibiting HCMV DNA replication. T-0902611 can be used in studies related to human cytomegalovirus infection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||