352431-50-6
Chemical Structure
17β-Estradiol sulfate-d4 sodium
Synonym(s): 17β-Estradiol 3-sulfate-d4 sodium
- CAS No.: 352431-50-6
- Formula:C18H19D4NaO5S
- Molecular Weight:378.45
IUPAC Name: sodium (8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-yl-2,4,16,16-d4 sulfate
InChIKey: LMJQCTISQYSLPF-LDBFCMRTSA-M
SMILES: C[C@@]12[C@](CC([2H])([2H])[C@@H]2O)([H])[C@@]3([H])[C@@](CC1)([H])C4=CC([2H])=C(OS(=O)(O[Na])=O)C([2H])=C4CC3
Biological Activity: 17β-Estradiol sulfate-d4 (sodium) is the deuterium labeled 17β-Estradiol sulfate 17β-Estradiol sulfate (sodium), also known as β-Estradiol 3-sulfate sodium salt, is a neuroactive steroid[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
17β-Estradiol sulfate-d4 sodium | 99.0% | 17β-Estradiol sulfate-d4 (sodium) is the deuterium labeled 17β-Estradiol sulfate 17β-Estradiol sulfate (sodium), also known as β-Estradiol 3-sulfate sodium salt, is a neuroactive steroid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
17β-Estradiol sulfate-d6 sodium | 17β-Estradiol sulfate-d3 sodium (17β-Estradiol 3-sulfate-d3 sodium) is the deuterium labeled 17β-Estradiol sulfate sodium (HY-141672). 17β-Estradiol sulfate sodium, also known as β-Estradiol 3-sulfate sodium salt, is a neuroactive steroid. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
17β-Estradiol sulfate sodium | 99.0% | 17β-Estradiol sulfate (sodium), also known as β-Estradiol 3-sulfate sodium salt, is a neuroactive steroid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
