36499-65-7
Chemical Structure
Dicobalt edetate
Synonym(s): Kelocyanor
- CAS No.: 36499-65-7
- Formula:C10H12Co2N2O8
- Molecular Weight:406.08
InChIKey: TWAWHTJKASJPEK-UHFFFAOYSA-J
SMILES: O=C1[O-][Co+2]2([O-]3)([O-]4)([O-]5)[N](CC3=O)(CC[N]2(CC5=O)CC4=O)C1.[Co+2]
Biological Activity: Dicobalt edetate (Kelocyanor) is a cobalt compound that is an antidote for hydrocyanic acid (cyanide) poisoning. Dicobalt edetate can form a stable complex with cyanide ions, thereby reducing the binding of cyanide ions to cytochrome oxidase, thereby preventing cyanide from inhibiting cellular respiration[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dicobalt edetate | 99.93% | Dicobalt edetate (Kelocyanor) is a cobalt compound that is an antidote for hydrocyanic acid (cyanide) poisoning. Dicobalt edetate can form a stable complex with cyanide ions, thereby reducing the binding of cyanide ions to cytochrome oxidase, thereby preventing cyanide from inhibiting cellular respiration. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||