382162-12-1
Chemical Structure
Phthalimide-PEG3-C2-OTs
- CAS No.: 382162-12-1
- Formula:C23H27NO8S
- Molecular Weight:477.53
IUPAC Name: 2-(2-(2-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate
InChIKey: LWPAUABODZZAIN-UHFFFAOYSA-N
SMILES: CC(C=C1)=CC=C1S(=O)(OCCOCCOCCOCCN2C(C3=C(C=CC=C3)C2=O)=O)=O
Biological Activity: Phthalimide-PEG3-C2-OTs (Compound 5) is a PROTAC linker, which refers to the PEGs composition. Phthalimide-PEG3-C2-OTs can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phthalimide-PEG3-C2-OTs | Phthalimide-PEG3-C2-OTs (Compound 5) is a PROTAC linker, which refers to the PEGs composition. Phthalimide-PEG3-C2-OTs can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||