51278-35-4
Chemical Structure
[Ala6]-LHRH
- CAS No.: 51278-35-4
- Formula:C56H77N17O13
- Molecular Weight:1196.32
InChIKey: SESQMDHICVIJCF-AVNYGLLKSA-N
SMILES: O=C([C@H]1NC(CC1)=O)N[C@@H](CC2=CN=CN2)C(N[C@H](C(N[C@@H](CO)C(N[C@H](C(N[C@@H](C)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N3[C@@H](CCC3)C(NCC(N)=O)=O)=O)=O)=O)=O)CC4=CC=C(C=C4)O)=O)=O)CC5=CNC6=CC=CC=C56)=O
Biological Activity: [Ala6]-LHRH is a synthetic luteinizing hormone-releasing hormone agonist, demonstrating effective stimulation of pituitary luteinizing hormone secretion. [Ala6]-LHRH enhances reproductive hormone regulation, contributing to fertility treatments. [Ala6]-LHRH plays a crucial role in managing conditions related to hormone imbalances.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
[Ala6]-LHRH | [Ala6]-LHRH is a synthetic luteinizing hormone-releasing hormone agonist, demonstrating effective stimulation of pituitary luteinizing hormone secretion. [Ala6]-LHRH enhances reproductive hormone regulation, contributing to fertility treatments. [Ala6]-LHRH plays a crucial role in managing conditions related to hormone imbalances. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||