51592-06-4
Chemical Structure
1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril
- CAS No.: 51592-06-4
- Formula:C16H10Cl4N4O2
- Molecular Weight:432.09
IUPAC Name: 1,3,4,6-tetrachloro-3a,6a-diphenyltetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
InChIKey: FJQZXCPWAGYPSD-UHFFFAOYSA-N
SMILES: O=C(N1Cl)N(Cl)C(C2=CC=CC=C2)(N(Cl)C(N3Cl)=O)C13C4=CC=CC=C4
Biological Activity: 1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril is a chemical agent that has the property of inhibiting enzyme activity in organisms. 1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril is used as a potential anti-tumor agent in compound development. 1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril has the effect of regulating cell signaling pathways and can be used to study cell biology. 1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril is considered to be a potent compound that can exert biological activity under specific conditions.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril | 98.0% | 1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril is a chemical agent that has the property of inhibiting enzyme activity in organisms. 1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril is used as a potential anti-tumor agent in compound development. 1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril has the effect of regulating cell signaling pathways and can be used to study cell biology. 1,3,4,6-Tetrachloro-3α,6α-diphenylglycouril is considered to be a potent compound that can exert biological activity under specific conditions. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
