5601-74-1
Chemical Structure
Ophiobolin B
- CAS. Nr.: 5601-74-1
- Formula:C25H38O4
- Molecular Weight:402.57
IUPAC Name: (1R,3aS,6aR,7S,9aR,10aS,E)-1,7-dihydroxy-1,9a-dimethyl-7-((S)-6-methylhept-5-en-2-yl)-3-oxo-1,2,3,3a,6,6a,7,8,9,9a,10,10a-dodecahydrodicyclopenta[a,d][8]annulene-4-carbaldehyde
InChIKey: SXRLPRKYTRWOES-PCQMDVLKSA-N
SMILES: C[C@@]12C[C@@]([C@@]3([H])/C(C=O)=C\C[C@@]1([H])[C@](CC2)([C@@H](C)CC/C=C(C)\C)O)([C@](C)(O)CC3=O)[H]
Biological Activity: Ophiobolin B, a sesterterpene metabolite of Helminthosporium oryzae, inhibits proton extrusion from maize coleoptiles. Ophiobolin B inhibits fusicoccin (FC) promoted proton extrusion, potassium uptake and cell enlargement[1]. The MIC values with the antifungal effect of Ophiobolins B on different zygomycetes is 25–50 μg/mL[2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ophiobolin B | 99.53% | Ophiobolin B, a sesterterpene metabolite of Helminthosporium oryzae, inhibits proton extrusion from maize coleoptiles. Ophiobolin B inhibits fusicoccin (FC) promoted proton extrusion, potassium uptake and cell enlargement. The MIC values with the antifungal effect of Ophiobolins B on different zygomycetes is 25–50 μg/mL. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Gianani L, et al. Effects of ophiobolin B on cell enlargement and H(+)/K (+) exchange in maize coleoptile tissues. Planta. 1979 Jan;146(3):271-4. [Content Brief]
- [2]. Krizsán K, et al. Effect of the sesterterpene-type metabolites, ophiobolins A and B, on zygomycetes fungi. FEMS Microbiol Lett. 2010 Dec;313(2):135-40. [Content Brief]
Keywords
