57359-00-9
Chemical Structure
Reactive orange 86
- CAS No.: 57359-00-9
- Formula:C20H11Cl2N8Na3O10S3
- Molecular Weight:759.42
IUPAC Name: sodium 7-((4-((4,6-dichloro-1,3,5-triazin-2-yl)amino)-2-ureidophenyl)diazenyl)naphthalene-1,3,6-trisulfonate
InChIKey: CMCWJAWGROJDDZ-MHAWFHQYSA-K
SMILES: O=C(NC1=CC(NC2=NC(Cl)=NC(Cl)=N2)=CC=C1/N=N/C3=C(S(=O)(O[Na])=O)C=C(C=C(S(=O)(O[Na])=O)C=C4S(=O)(O[Na])=O)C4=C3)N
Biological Activity: Reactive orange 86 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Reactive orange 86 | Reactive orange 86 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||