6372-42-5
Chemical Structure
Cyclohexyldiphenylphosphine
- CAS No.: 6372-42-5
- Formula:C18H21P
- Molecular Weight:268.34
IUPAC Name: Cyclohexyldiphenylphosphine
InChIKey: ZXKWUYWWVSKKQZ-UHFFFAOYSA-N
SMILES: C1CCC(CC1)P(C1=CC=CC=C1)C1=CC=CC=C1
Biological Activity: Cyclohexyldiphenylphosphine is a chemical compound commonly used as a ligand in coordination chemistry and organometallic synthesis. Cyclohexyldiphenylphosphine facilitates various catalytic reactions through acting as a stabilizing agent. Cyclohexyldiphenylphosphine is a ligand for some nickel(II) complexes. Cyclohexyldiphenylphosphine exhibits anti-cancer properties against SNO cancer cells when formed complex with silver[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cyclohexyldiphenylphosphine | 99.99% | Cyclohexyldiphenylphosphine is a chemical compound commonly used as a ligand in coordination chemistry and organometallic synthesis. Cyclohexyldiphenylphosphine facilitates various catalytic reactions through acting as a stabilizing agent. Cyclohexyldiphenylphosphine is a ligand for some nickel(II) complexes. Cyclohexyldiphenylphosphine exhibits anti-cancer properties against SNO cancer cells when formed complex with silver. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Potgieter, K., et al., (2017). Anticancer activity of silver(I) cyclohexyldiphenylphosphine complexes toward SNO cancer cells. Journal of Coordination Chemistry, 70(15), 2644–2658.
- [2]. Liu, XF. Synthesis, spectroscopic characterization, and crystal structures of diiron pentacarbonyl complexes with monosubstituted tris(3-chlorophenyl)phosphine or cyclohexyldiphenylphosphine ligands. Transition Met Chem 40, 923–927 (2015).
- [3]. Gadada Naganagowda, et al., (2023). Synthesis, crystal structure and spectral studies of silver(I) cyclohexyldiphenylphosphine complexes: towards the biological evaluation on malignant and non-malignant cells. Journal of Coordination Chemistry, 76(1):45-60.