951671-87-7
Chemical Structure
DNP-PEG3-azide
- CAS No.: 951671-87-7
- Formula:C14H20N6O7
- Molecular Weight:384.34
IUPAC Name: N-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)-2,4-dinitroaniline
InChIKey: FIAOTUUAWJBUBV-UHFFFAOYSA-N
SMILES: O=[N+](C1=CC=C(NCCOCCOCCOCCN=[N+]=[N-])C([N+]([O-])=O)=C1)[O-]
Biological Activity: DNP-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. DNP-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DNP-PEG3-azide | 99.18% | DNP-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. DNP-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||