95733-02-1
Chemical Structure
Daphnodorin B
- CAS No.: 95733-02-1
- Formula:C30H22O10
- Molecular Weight:542.49
IUPAC Name: ((2R,3S)-3,5-dihydroxy-2,8-bis(4-hydroxyphenyl)-3,4-dihydro-2H-furo[2,3-h]chromen-9-yl)(2,4,6-trihydroxyphenyl)methanone
InChIKey: JBNFGJOTOPTIDE-RBISFHTESA-N
SMILES: O=C(C1=C(C2=CC=C(O)C=C2)OC3=C1C(O[C@@H]([C@H](C4)O)C5=CC=C(C=C5)O)=C4C(O)=C3)C6=C(O)C=C(O)C=C6O
Biological Activity: Daphnodorin B is a flavonoid. Daphnodorin B can be isolated from the roots of Daphne genkwa. Daphnodorin B can be used for the research of tumor[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Daphnodorin B | Daphnodorin B is a flavonoid. Daphnodorin B can be isolated from the roots of Daphne genkwa. Daphnodorin B can be used for the research of tumor. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||