103336-05-6
Chemical Structure
Ditekiren
Synonym(s): U 71038
- CAS No.: 103336-05-6
- Formula:C50H75N9O8
- Molecular Weight:930.19
IUPAC Name: tert-butyl (S)-2-(((4S,7S,9S,10S,13S,16S)-13-((1H-imidazol-5-yl)methyl)-4-((S)-sec-butyl)-9-hydroxy-10-isobutyl-7-isopropyl-14-methyl-3,6,12,15-tetraoxo-17-phenyl-1-(pyridin-2-yl)-2,5,11,14-tetraazaheptadecan-16-yl)carbamoyl)pyrrolidine-1-carboxylate
InChIKey: SASWSEQJAITMKS-JJNNLWIXSA-N
SMILES: O=C(NCC1=CC=CC=N1)[C@H]([C@@H](C)CC)NC([C@H](C(C)C)C[C@H](O)[C@H](CC(C)C)NC([C@H](CC2=CN=CN2)N(C)C([C@H](CC3=CC=CC=C3)NC([C@H]4N(CCC4)C(OC(C)(C)C)=O)=O)=O)=O)=O
Biological Activity: Ditekiren (U 71038) is a pseudohexapeptide renin inhibitor. Renin is an enzyme that plays a crucial role in regulating blood pressure and fluid balance. By inhibiting the activity of renin, ditekiren slows down the formation of angiotensin II, a potent vasoconstrictor that can raise blood pressure. Ditekiren can be used for research in the field of blood pressure reduction[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ditekiren | Ditekiren (U 71038) is a pseudohexapeptide renin inhibitor. Renin is an enzyme that plays a crucial role in regulating blood pressure and fluid balance. By inhibiting the activity of renin, ditekiren slows down the formation of angiotensin II, a potent vasoconstrictor that can raise blood pressure. Ditekiren can be used for research in the field of blood pressure reduction. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||