108351-51-5
Chemical Structure
Glidobactin B
- CAS No.: 108351-51-5
- Formula:C29H46N4O6
- Molecular Weight:546.70
InChIKey: AZHZGGIJCMPFMJ-QTMCTTMVSA-N
SMILES: CCCCC/C=C/CC/C=C/C=C/C(N[C@H](C(N[C@@H]1C(N[C@@H](C)/C=C/C(NCC[C@H](O)C1)=O)=O)=O)[C@H](O)C)=O
Biological Activity: Glidobactin B is an anti-tumor antibiotic. Glidobactin B has the activity against pathogenic fungi and yeast. Glidobactin B also extends the survival of mice inoculated with leukemia P388 cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Glidobactin B | Glidobactin B is an anti-tumor antibiotic. Glidobactin B has the activity against pathogenic fungi and yeast. Glidobactin B also extends the survival of mice inoculated with leukemia P388 cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||