1096439-18-7
Chemical Structure
Phenol-amido-C1-PEG3-N3
Synonym(s): PROTAC Linker 21
- CAS No.: 1096439-18-7
- Formula:C14H20N4O5
- Molecular Weight:324.33
IUPAC Name: 2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)-N-(4-hydroxyphenyl)acetamide
InChIKey: UIVPCIQDQHNCCO-UHFFFAOYSA-N
SMILES: O=C(NC1=CC=C(O)C=C1)COCCOCCOCCN=[N+]=[N-]
Biological Activity: Phenol-amido-C1-PEG3-N3 (PROTAC Linker 21) is an PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. Phenol-amido-C1-PEG3-N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phenol-amido-C1-PEG3-N3 | 99.87% | Phenol-amido-C1-PEG3-N3 (PROTAC Linker 21) is an PEG-based PROTAC linker can be used in the synthesis of PROTACs. Phenol-amido-C1-PEG3-N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||