114495-85-1
Chemical Structure
Hepatitis B Virus Receptor Binding Fragment
Synonym(s): hepatitis B peptide 4980
- CAS No.: 114495-85-1
- Formula:C140H185N35O42
- Molecular Weight:3030.18
SMILES: O=C([C@H]1N(CCC1)C([C@H](CC(N)=O)NC([C@H](CC(N)=O)NC([C@H](CO)NC([C@H](CC(N)=O)NC([C@H](C)NC(CNC([C@@H](NC([C@H](C)NC([C@H]2N(CCC2)C([C@H](CC(O)=O)NC([C@H](CC(C)C)NC([C@H](CCC(N)=O)NC([C@@H](NC([C@H](CC(O)=O)NC([C@H]3N(CCC3)C([C@@H](NC([C@@H](NC(CNC([C@H](CC(C)C)NC([C@@H]4CCCN4)=O)=O)=O)CC5=CC=CC=C5)=O)CC6=CC=CC=C6)=O)=O)=O)CC7=CN=CN7)=O)=O)=O)=O)=O)=O)CC8=CC=CC=C8)=O)=O)=O)=O)=O)=O)=O)N[C@@H](CC(O)=O)C(N[C@H](C(N[C@@H](CC(O)=O)C(N[C@H](C(N[C@@H](CC(N)=O)C(N9[C@@H](CCC9)C(O)=O)=O)=O)CC%10=CC=CC=C%10)=O)=O)CC%11=CNC%12=CC=CC=C%11%12)=O
Biological Activity: Hepatitis B Virus Receptor Binding Fragment (hepatitis B peptide 4980) is a synthetic peptide analog which specifically binds to Hep G2 cells. Hepatitis B Virus Receptor Binding Fragment is a promising immunogen expected to elicit protective antibodies based on the concept of the attachment blockade pathway of virus neutralization[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Hepatitis B Virus Receptor Binding Fragment | Hepatitis B Virus Receptor Binding Fragment (hepatitis B peptide 4980) is a synthetic peptide analog which specifically binds to Hep G2 cells. Hepatitis B Virus Receptor Binding Fragment is a promising immunogen expected to elicit protective antibodies based on the concept of the attachment blockade pathway of virus neutralization. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Neurath AR, et al. Identification and chemical synthesis of a host cell receptor binding site on hepatitis B virus. Cell. 1986 Aug 1;46(3):429-36. [Content Brief]
- [2]. López R, et al. Plasmodium falciparum: binding studies of peptide derived from the sporozoite surface protein 2 to Hep G2 cells. J Pept Res. 2001 Oct;58(4):285-92. [Content Brief]
