1151511-05-5
Chemical Structure
Herbaridine B
- CAS No.: 1151511-05-5
- Formula:C17H20O6
- Molecular Weight:320.34
IUPAC Name: (3R,4aS,10aR)-3,7,9-trimethoxy-3-methyl-3,4,4a,10a-tetrahydro-1H-benzo[g]isochromene-5,10-dione
InChIKey: XWDPPCCHTXTSRZ-NVGCLXPQSA-N
SMILES: O=C1C2=C(OC)C=C(OC)C=C2C([C@]3([H])[C@]1([H])CO[C@](C)(C3)OC)=O
Biological Activity: Herbaridine B is a potential fungal secondary metabolite that can be extracted from the fungus Anteaglonium FL0768. This fungus was isolated as an endophyte from the photosynthetic tissue of Selaginella arenicola[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Herbaridine B | Herbaridine B is a potential fungal secondary metabolite that can be extracted from the fungus Anteaglonium FL0768. This fungus was isolated as an endophyte from the photosynthetic tissue of Selaginella arenicola. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||