1159408-65-7
Chemical Structure
Tri-GalNAc(OAc)3 TFA
- CAS No.: 1159408-65-7
- Formula:C81H129F3N10O38
- Molecular Weight:1907.93
InChIKey: ZQQFLUVDYMPTBZ-QBHSIBJISA-N
SMILES: CC(O[C@@H]1[C@H]([C@@H](O[C@@H]([C@@H]1OC(C)=O)COC(C)=O)OCCCCC(NCCCNC(CCOCC(COCCC(NCCCNC(CCCCO[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)COC(C)=O)OC(C)=O)OC(C)=O)NC(C)=O)=O)=O)(N)COCCC(NCCCNC(CCCCO[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)COC(C)=O)OC(C)=O)OC(C)=O)NC(C)=O)=O)=O)=O)=O)NC(C)=O)=O.OC(C(F)(F)F)=O
Biological Activity: Tri-GalNAc(OAc)3 TFA is a trivalent N-acetylgalactosamine (GalNAc) derivative that can be used to synthesize GalNAc-LYTAC. Tri-GalNAc is a specific ligand targeting the asialoglycoprotein receptor (ASGPR), mediating the endocytosis and transport of cell surface proteins (such as EGFR, HER2) to lysosomes for degradation by lysosomal targeting chimeras (LYTACs). Tri-GalNAc significantly reduces the level of target proteins and inhibits downstream signaling pathways (such as EGFR-mediated Akt and MAPK signals). Tri-GalNAc(OAc)3 TFA can be used for hepatocyte targeting studies, and can degrade carcinogenic membrane proteins and inhibit tumor cell proliferation in liver cancer cell models[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tri-GalNAc(OAc)3 TFA | 98.09% | Tri-GalNAc(OAc)3 TFA is a trivalent N-acetylgalactosamine (GalNAc) derivative that can be used to synthesize GalNAc-LYTAC. Tri-GalNAc is a specific ligand targeting the asialoglycoprotein receptor (ASGPR), mediating the endocytosis and transport of cell surface proteins (such as EGFR, HER2) to lysosomes for degradation by lysosomal targeting chimeras (LYTACs). Tri-GalNAc significantly reduces the level of target proteins and inhibits downstream signaling pathways (such as EGFR-mediated Akt and MAPK signals). Tri-GalNAc(OAc)3 TFA can be used for hepatocyte targeting studies, and can degrade carcinogenic membrane proteins and inhibit tumor cell proliferation in liver cancer cell models. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||