118292-35-6
Chemical Structure
Pyrindamycin B
- CAS No.: 118292-35-6
- Formula:C26H26ClN3O8
- Molecular Weight:543.95
IUPAC Name: methyl (2R,8S)-8-chloro-4-hydroxy-2-methyl-1-oxo-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3,6,7,8,9-hexahydro-1H-pyrrolo[3,2-f]quinoline-2-carboxylate
InChIKey: ILRQRCTVPANBBE-GWQKEKGPSA-N
SMILES: O=C([C@@](N1)(C)C(C2=C1C(O)=CC3=C2C[C@H](Cl)CN3C(C(N4)=CC5=C4C(OC)=C(OC)C(OC)=C5)=O)=O)OC
Biological Activity: Pyrindamycin B is an antibiotic, actives against gram-positive and gram-negative bacterias, and exhibits strong therapeutic effects against both agent-sensitive and resistant cells of P388 leukemia in mice[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pyrindamycin B | Pyrindamycin B is an antibiotic, actives against gram-positive and gram-negative bacterias, and exhibits strong therapeutic effects against both agent-sensitive and resistant cells of P388 leukemia in mice. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||