1183-04-6
Chemical Structure
Cholesterol decanoate
- CAS No.: 1183-04-6
- Formula:C37H64O2
- Molecular Weight:540.90
IUPAC Name: (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-((R)-6-methylheptan-2-yl)-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl decanoate
InChIKey: LJGMGXXCKVFFIS-IATSNXCDSA-N
SMILES: CCCCCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1
Biological Activity: Cholesterol decanoate is an organic compound belonging to the class of esters. It is formed from the reaction between cholesterol and capric acid. Cholesterol decanoate has several applications in the pharmaceutical industry, particularly as a bioactive compound with potential research potential for improving a range of medical conditions, such as high cholesterol and inflammation-related diseases. Additionally, it has potential applications as a food additive to improve texture and stability.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cholesterol decanoate | 99.86% | Cholesterol decanoate is an organic compound belonging to the class of esters. It is formed from the reaction between cholesterol and capric acid. Cholesterol decanoate has several applications in the pharmaceutical industry, particularly as a bioactive compound with potential research potential for improving a range of medical conditions, such as high cholesterol and inflammation-related diseases. Additionally, it has potential applications as a food additive to improve texture and stability. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
