1185410-60-9
Chemical Structure
LRH-1 Inhibitor-3
- CAS No.: 1185410-60-9
- Formula:C23H25N3O2
- Molecular Weight:375.46
IUPAC Name: 1-(3'-(1-(2-morpholinoethyl)-1H-pyrazol-3-yl)-[1,1'-biphenyl]-3-yl)ethan-1-one
InChIKey: SLRQICGVSRRRDI-UHFFFAOYSA-N
SMILES: CC(C1=CC(C2=CC=CC(C3=NN(C=C3)CCN4CCOCC4)=C2)=CC=C1)=O
Biological Activity: LRH-1 Inhibitor-3 is a small molecule that inhibits LRH-1 transcriptional activity, thereby decreasing the expression of target genes associated with cell growth and proliferation. LRH-1 Inhibitor-3 has shown potential in reducing cancer cell proliferation in human pancreatic, colon, and breast adenocarcinoma cell lines. LRH-1 Inhibitor-3 serves as a molecular probe for investigating the role of LRH-1 in various malignancies.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
LRH-1 Inhibitor-3 | 98.81% | LRH-1 Inhibitor-3 is a small molecule that inhibits LRH-1 transcriptional activity, thereby decreasing the expression of target genes associated with cell growth and proliferation. LRH-1 Inhibitor-3 has shown potential in reducing cancer cell proliferation in human pancreatic, colon, and breast adenocarcinoma cell lines. LRH-1 Inhibitor-3 serves as a molecular probe for investigating the role of LRH-1 in various malignancies. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||