1195053-25-8
![Neu5GcAc[1Me,478Ac,9N3]-β-SPh Chemical Structure](http://file.medchemexpress.cn/product_pic/hy-w145531.gif "Neu5GcAc[1Me,478Ac,9N3]-β-SPh Chemical Structure")
Chemical Structure
Neu5GcAc[1Me,478Ac,9N3]-β-SPh
- CAS No.: 1195053-25-8
- Formula:C26H32N4O12S
- Molecular Weight:624.62
IUPAC Name: (1R,2R)-1-((2R,3R,4S,6R)-4-acetoxy-3-(2-acetoxyacetamido)-6-(methoxycarbonyl)-6-(phenylthio)tetrahydro-2H-pyran-2-yl)-3-azidopropane-1,2-diyl diacetate
InChIKey: YBDMZZOROXIIKI-YJGXBXLCSA-N
SMILES: COC([C@]1(O[C@@]([C@@H]([C@H](C1)OC(C)=O)NC(COC(C)=O)=O)([H])[C@H](OC(C)=O)[C@H](OC(C)=O)CN=[N+]=[N-])SC2=CC=CC=C2)=O
Biological Activity: Neu5GcAc[1Me,478Ac,9N3]-β-SPh is a biochemical reagent that can be used as a biological material or organic compound for life science related research. Neu5GcAc[1Me,478Ac,9N3]-β-SPh is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Neu5GcAc[1Me,478Ac,9N3]-β-SPh | Neu5GcAc[1Me,478Ac,9N3]-β-SPh is a biochemical reagent that can be used as a biological material or organic compound for life science related research. Neu5GcAc[1Me,478Ac,9N3]-β-SPh is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
