1206881-48-2
Chemical Structure
Armeniaspirol B
- CAS No.: 1206881-48-2
- Formula:C18H19Cl2NO4
- Molecular Weight:384.25
InChIKey: WBYVIPGWSMCVAL-SFHVURJKSA-N
SMILES: O=C1[C@]2(C(Cl)=C(C(N2C)=O)Cl)OC3=C(CCCC(C)C)C(O)=CC=C31
Biological Activity: Armeniaspirol B is a selective antibiotic targeting Gram-positive pathogens, showing MIC values of 0.5 μg/mL against S. aureus Newman and 2.0 μg/mL against S. aureus USA300. Armeniaspirol B is promising for research of Gram-positive bacterial infections (e.g., MRSA, VRE infections)[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Armeniaspirol B | Armeniaspirol B is a selective antibiotic targeting Gram-positive pathogens, showing MIC values of 0.5 μg/mL against S. aureus Newman and 2.0 μg/mL against S. aureus USA300. Armeniaspirol B is promising for research of Gram-positive bacterial infections (e.g., MRSA, VRE infections). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords