1207714-69-9
Chemical Structure
Azido-PEG9-amine
- CAS No.: 1207714-69-9
- Formula:C20H42N4O9
- Molecular Weight:482.57
IUPAC Name: 29-azido-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-amine
InChIKey: QECAUUOGHAUEDJ-UHFFFAOYSA-N
SMILES: NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG9-amine is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG9-amine is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG9-amine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG9-amine | 98.0% | Azido-PEG9-amine is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG9-amine is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG9-amine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
