121245-07-6
Chemical Structure
Tetracenomycin X
- CAS No.: 121245-07-6
- Formula:C24H22O11
- Molecular Weight:486.42
InChIKey: QSPIPUXWSNFXCK-AGILITTLSA-N
SMILES: CO[C@@]12[C@@](C(C(C(C1=O)=C(C3=C4C)O)=CC3=CC(OC)=C4C(OC)=O)=O)([C@@H](C(OC)=CC2=O)O)O
Biological Activity: Tetracenomycin X is a natural aromatic polyketide compound. Tetracenomycin X can inhibit peptide bond formation between an incoming aminoacyl-tRNA and a terminal Gln-Lys (QK) motif in the nascent polypeptide. Tetracenomycin X can be used for the development of novel aromatic polyketide antibiotics [1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tetracenomycin X | Tetracenomycin X is a natural aromatic polyketide compound. Tetracenomycin X can inhibit peptide bond formation between an incoming aminoacyl-tRNA and a terminal Gln-Lys (QK) motif in the nascent polypeptide. Tetracenomycin X can be used for the development of novel aromatic polyketide antibiotics . | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords