1213701-11-1
Chemical Structure
Ac4ManNAz
- CAS. Nr.: 1213701-11-1
- Formula:C16H22N4O10
- Molecular Weight:430.37
InChIKey: HGMISDAXLUIXKM-ZIRHEVKLSA-N
SMILES: CC(O[C@@H]1[C@@H]([C@H](O[C@@H]([C@H]1OC(C)=O)COC(C)=O)OC(C)=O)NC(CN=[N+]=[N-])=O)=O
Biological Activity: Ac4ManNAz can be taken up by cells and is an azide-containing metabolic glycoprotein labeling reagent that selectively modifies proteins. Commonly used for cell labeling, tracking and proteomic analysis. Ac4ManNAz contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Ac4ManNAz can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ac4ManNAz | 99.94% | Ac4ManNAz can be taken up by cells and is an azide-containing metabolic glycoprotein labeling reagent that selectively modifies proteins. Commonly used for cell labeling, tracking and proteomic analysis. Ac4ManNAz contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Ac4ManNAz can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
