1217460-44-0
Chemical Structure
L-Lysine-15N2 hydrochloride
- CAS No.: 1217460-44-0
- Formula:C6H15Cl15N2O2
- Molecular Weight:184.64
IUPAC Name: L-lysine-15N2 hydrochloride
InChIKey: BVHLGVCQOALMSV-XVXIHWTMSA-N
SMILES: [15NH2]CCCC[C@H]([15NH2])C(O)=O.[H]Cl
Biological Activity: L-Lysine-15N2 (hydrochloride) is the 15N-labeled L-Lysine hydrochloride. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Lysine-15N2 hydrochloride | 98.0% | L-Lysine-15N2 (hydrochloride) is the 15N-labeled L-Lysine hydrochloride. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine hydrochloride (Standard) | ≥98% | L-Lysine hydrochloride (Standard) is the analytical standard of L-Lysine hydrochloride. This product is intended for research and analytical applications. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine-d3 hydrochloride | L-Lysine-d3 (hydrochloride) is the deuterium labeled L-Lysine. L-lysine is an essential amino acid with important roles in connective tissues and carnitine synthesis, energy production, growth in children, and maintenance of immune functions. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine-13C6,15N2 hydrochloride | 99.93% | L-Lysine-13C6,15N2 (hydrochloride) is the 13C- and 15N-labeled L-Lysine hydrochloride. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine-d8 hydrochloride | 99.88% | L-Lysine-d8 (hydrochloride) is the deuterium labeled L-Lysine hydrochloride. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine-13C dihydrochloride | 99.90% | L-Lysine-13C (dihydrochloride) is the 13C-labeled L-Lysine dihydrochloride. L-lysine dihydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine-13C6 hydrochloride | 98.0% | L-Lysine-13C6 hydrochloride is the 13C labeled L-Lysine hydrochloride. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine-d9 hydrochloride | 99.0% | L-Lysine-d9 (hydrochloride) is the deuterium labeled L-Lysine. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine-d4 hydrochloride | 99.78% | L-Lysine-d4 (hydrochloride) is the deuterium labeled L-Lysine. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine-13C6,15N2,d9 dihydrochloride | L-Lysine-13C6,15N2,d9 (dihydrochloride) is the deuterium, 13C-, and 15-labeled L-Lysine hydrochloride. L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Lysine hydrochloride | 99.95% | L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
- L-Lysine-15N2 hydrochloride
- L-Lysine hydrochloride (Standard)
- L-Lysine-d3 hydrochloride
- L-Lysine-13C6,15N2 hydrochloride
- L-Lysine-d8 hydrochloride
- L-Lysine-13C dihydrochloride
- L-Lysine-13C6 hydrochloride
- L-Lysine-d9 hydrochloride
- L-Lysine-d4 hydrochloride
- L-Lysine-13C6,15N2,d9 dihydrochloride
- L-Lysine hydrochloride