1219798-76-1
Chemical Structure
p-Toluic acid-d7
Synonym(s): 4-Methylbenzoic acid-d7
- CAS No.: 1219798-76-1
- Formula:C8HD7O2
- Molecular Weight:143.19
IUPAC Name: 4-(methyl-d3)benzoic-2,3,5,6-d4 acid
InChIKey: LPNBBFKOUUSUDB-AAYPNNLASA-N
SMILES: O=C(O)C1=C([2H])C([2H])=C(C([2H])([2H])[2H])C([2H])=C1[2H]
Biological Activity: p-Toluic acid-d7 is the deuterium labeled p-Toluic acid[1]. p-Toluic acid (4-Methylbenzoic acid) is a substituted benzoic acid and can be used as an intermediate for the synthesis of para-aminomethylbenzoic acid (PAMBA), p-tolunitrile, etc.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
p-Toluic acid-d7 | 99.72% | p-Toluic acid-d7 is the deuterium labeled p-Toluic acid. p-Toluic acid (4-Methylbenzoic acid) is a substituted benzoic acid and can be used as an intermediate for the synthesis of para-aminomethylbenzoic acid (PAMBA), p-tolunitrile, etc. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
p-Toluic acid (Standard) | ≥98% | p-Toluic acid (Standard) is the analytical standard of p-Toluic acid. This product is intended for research and analytical applications. p-Toluic acid (4-Methylbenzoic acid), coumarin, is a substituted benzoic acid. p-Toluic acidis synthetic p-aminomethylbenzoic acid (PAMBA), intermediates such as p-toluonitrile. p-Toluic acidMay have potential reproductive toxicity, press 1g/kgRepeated administration of doses can produce a variety of adverse effects on the epididymis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
p-Toluic acid-d4 | p-Toluic acid-d4 is the deuterium labeled p-Toluic acid. p-Toluic acid (4-Methylbenzoic acid) is a substituted benzoic acid and can be used as an intermediate for the synthesis of para-aminomethylbenzoic acid (PAMBA), p-tolunitrile, etc. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
p-Toluic acid-d3 | 99% | p-Toluic acid-d3 is the deuterium labeled p-Toluic acid. p-Toluic acid (4-Methylbenzoic acid) is a substituted benzoic acid and can be used as an intermediate for the synthesis of para-aminomethylbenzoic acid (PAMBA), p-tolunitrile, etc. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
p-Toluic acid | 99.93% | p-Toluic acid (4-Methylbenzoic acid), coumarin, is a substituted benzoic acid. p-Toluic acidis synthetic p-aminomethylbenzoic acid (PAMBA), intermediates such as p-toluonitrile. p-Toluic acidMay have potential reproductive toxicity, press 1g/kgRepeated administration of doses can produce a variety of adverse effects on the epididymis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||