122510-61-6
Chemical Structure
AF615
- CAS No.: 122510-61-6
- Formula:C10H13N5O2S
- Molecular Weight:267.31
SMILES: O=C(C1=NC=CN=C1)NNC(N2CCOCC2)=S
Biological Activity: AF615 is a small molecule inhibitor targeting the CDT1/Geminin protein complex (IC50 = 0.313 μM). AF615 selectively induces DNA damage, inhibits DNA synthesis, causes cell cycle arrest, and decreases the survival rate in cancer cell lines. AF615 displayed a Ki = 0.37 μM in case of Geminin-tCDT1 interaction and a Ki = 0.75 μM in case of Geminin-miniCDT1 interaction[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
AF615 | 99.55% | AF615 is a small molecule inhibitor targeting the CDT1/Geminin protein complex (IC50 = 0.313 μM). AF615 selectively induces DNA damage, inhibits DNA synthesis, causes cell cycle arrest, and decreases the survival rate in cancer cell lines. AF615 displayed a Ki = 0.37 μM in case of Geminin-tCDT1 interaction and a Ki = 0.75 μM in case of Geminin-miniCDT1 interaction. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||