1245447-09-9
Chemical Structure
Farobin B
- CAS No.: 1245447-09-9
- Formula:C27H30O14
- Molecular Weight:578.52
InChIKey: NJNUVWMGNSDFQJ-GIZWKEFHSA-N
SMILES: OC1=C2C(OC(C3=CC(O)=C(C=C3)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)=CC2=O)=CC(O)=C1[C@H]5C[C@@H]([C@H]([C@H](O5)C)O)O
Biological Activity: Farobin B (compound 2) is a flavonoid glycoside antioxidant that scavenges reactive oxygen species and exhibits activity in the ORAC assay. Farobin B is found in the leaves of Fargesia robusta 'Pingwu'[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Farobin B | Farobin B (compound 2) is a flavonoid glycoside antioxidant that scavenges reactive oxygen species and exhibits activity in the ORAC assay. Farobin B is found in the leaves of Fargesia robusta 'Pingwu'. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||